C13H18O2 — CID 23245250
(1aR,4aR,5R,8aS)-4a-prop-2-enyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol (PubChem CID 23245250) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1aR,4aR,5R,8aS)-4a-prop-2-enyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol.
| Compound Name | (1aR,4aR,5R,8aS)-4a-prop-2-enyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
|---|---|
| PubChem CID | 23245250 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1aR,4aR,5R,8aS)-4a-prop-2-enyl-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
| SMILES | C=CC[C@]12C=CC[C@H]3O[C@]31CCC[C@H]2O |
| InChI | InChI=1S/C13H18O2/c1-2-7-12-8-4-6-11-13(12,15-11)9-3-5-10(12)14/h2,4,8,10-11,14H,1,3,5-7,9H2/t10-,11-,12-,13-/m1/s1 |
| InChIKey | PDUJPWXKRJVULX-FDYHWXHSSA-N |
| XLogP | 2.19 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|