C10H13N5S — CID 114697887
N-pyrrolidin-3-yl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 114697887) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine.
| Compound Name | N-pyrrolidin-3-yl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 114697887 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-pyrrolidin-3-yl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | c1csc(-c2cc(NC3CCNC3)n[nH]2)n1 |
| InChI | InChI=1S/C10H13N5S/c1-2-11-6-7(1)13-9-5-8(14-15-9)10-12-3-4-16-10/h3-5,7,11H,1-2,6H2,(H2,13,14,15) |
| InChIKey | LAJYAOHYOUHEKS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |