C9H16N2S4 — CID 11471528
[(E)-3-(dimethylcarbamothioylsulfanyl)prop-2-enyl] N,N-dimethylcarbamodithioate (PubChem CID 11471528) has the molecular formula C9H16N2S4 and a molecular weight of 280.51 g/mol. Its IUPAC name is [(E)-3-(dimethylcarbamothioylsulfanyl)prop-2-enyl] N,N-dimethylcarbamodithioate.
| Compound Name | [(E)-3-(dimethylcarbamothioylsulfanyl)prop-2-enyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 11471528 |
| Molecular Formula | C9H16N2S4 |
| Molecular Weight | 280.51 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | [(E)-3-(dimethylcarbamothioylsulfanyl)prop-2-enyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)S/C=C/CSC(=S)N(C)C |
| InChI | InChI=1S/C9H16N2S4/c1-10(2)8(12)14-6-5-7-15-9(13)11(3)4/h5-6H,7H2,1-4H3/b6-5+ |
| InChIKey | NBALUJWXYQAPEK-AATRIKPKSA-N |
| XLogP | 2.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|