C11H18N2O3SSi — CID 11471710
2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 11471710) has the molecular formula C11H18N2O3SSi and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11471710 |
| Molecular Formula | C11H18N2O3SSi |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O/N=C/c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H18N2O3SSi/c1-11(2,3)18(4,5)16-12-6-9-13-8(7-17-9)10(14)15/h6-7H,1-5H3,(H,14,15)/b12-6+ |
| InChIKey | ZPFWTXSAPGSYDR-WUXMJOGZSA-N |
| XLogP | 3.20 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|