About 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid
2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 11471710) has the molecular formula C11H18N2O3SSi
and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 11471710 |
| Molecular Formula | C11H18N2O3SSi |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O/N=C/c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H18N2O3SSi/c1-11(2,3)18(4,5)16-12-6-9-13-8(7-17-9)10(14)15/h6-7H,1-5H3,(H,14,15)/b12-6+ |
| InChIKey | ZPFWTXSAPGSYDR-WUXMJOGZSA-N |
| XLogP | 3.20 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid (CID 11471710) is 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid is CC(C)(C)[Si](C)(C)O/N=C/c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is ZPFWTXSAPGSYDR-WUXMJOGZSA-N. The full InChI is InChI=1S/C11H18N2O3SSi/c1-11(2,3)18(4,5)16-12-6-9-13-8(7-17-9)10(14)15/h6-7H,1-5H3,(H,14,15)/b12-6+.
What are the key properties of 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid?
2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 286.43 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-[tert-butyl(dimethyl)silyl]oxyiminomethyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 11471710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).