C7H8N2O3S — CID 104771692
2-[(4-methyl-1,3-thiazol-2-yl)methylideneamino]oxyacetic acid (PubChem CID 104771692) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methylideneamino]oxyacetic acid.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 104771692 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)methylideneamino]oxyacetic acid |
| SMILES | Cc1csc(C=NOCC(=O)O)n1 |
| InChI | InChI=1S/C7H8N2O3S/c1-5-4-13-6(9-5)2-8-12-3-7(10)11/h2,4H,3H2,1H3,(H,10,11) |
| InChIKey | NAOZLSPMEKUPAB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|