C5H6N2OS — CID 136739066
N-[(4-methyl-1,3-thiazol-2-yl)methylidene]hydroxylamine (PubChem CID 136739066) has the molecular formula C5H6N2OS and a molecular weight of 142.18 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methylidene]hydroxylamine.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 136739066 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methylidene]hydroxylamine |
| SMILES | Cc1csc(C=NO)n1 |
| InChI | InChI=1S/C5H6N2OS/c1-4-3-9-5(7-4)2-6-8/h2-3,8H,1H3 |
| InChIKey | BZTZJWRPKGOMKQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|