About (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine
(E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine (PubChem CID 104771695) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine |
| PubChem CID | 104771695 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine |
| SMILES | Cc1csc(/C=C/CCN)n1 |
| InChI | InChI=1S/C8H12N2S/c1-7-6-11-8(10-7)4-2-3-5-9/h2,4,6H,3,5,9H2,1H3/b4-2+ |
| InChIKey | SMQURBGENWUGRI-DUXPYHPUSA-N |
| XLogP | 1.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine?
The IUPAC name of (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine (CID 104771695) is (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine.
What is the SMILES notation for (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine?
The canonical SMILES for (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine is Cc1csc(/C=C/CCN)n1.
What is the InChIKey of (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine?
The InChIKey is SMQURBGENWUGRI-DUXPYHPUSA-N. The full InChI is InChI=1S/C8H12N2S/c1-7-6-11-8(10-7)4-2-3-5-9/h2,4,6H,3,5,9H2,1H3/b4-2+.
What are the key properties of (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine?
(E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine has a molecular weight of 168.26 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(4-methyl-1,3-thiazol-2-yl)but-3-en-1-amine is sourced from PubChem (CID 104771695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).