C11H16N2OS — CID 102230769
(E)-N-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 102230769) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is (E)-N-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 102230769 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (E)-N-tert-butyl-3-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1csc(/C=C/C(=O)NC(C)(C)C)n1 |
| InChI | InChI=1S/C11H16N2OS/c1-8-7-15-10(12-8)6-5-9(14)13-11(2,3)4/h5-7H,1-4H3,(H,13,14)/b6-5+ |
| InChIKey | JUHCPKNEAVMSCE-AATRIKPKSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|