C16H19N3O2 — CID 114751786
N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 114751786) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 114751786 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC1(CCO)CC1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H19N3O2/c20-9-8-16(6-7-16)11-17-15(21)14-10-13(18-19-14)12-4-2-1-3-5-12/h1-5,10,20H,6-9,11H2,(H,17,21)(H,18,19) |
| InChIKey | WCKGWCCHBZXGCT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |