C16H15ClN2S — CID 114754541
4-(3-chloropropyl)-2-(4-methylquinolin-2-yl)-1,3-thiazole (PubChem CID 114754541) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2-(4-methylquinolin-2-yl)-1,3-thiazole.
| Compound Name | 4-(3-chloropropyl)-2-(4-methylquinolin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 114754541 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-(3-chloropropyl)-2-(4-methylquinolin-2-yl)-1,3-thiazole |
| SMILES | Cc1cc(-c2nc(CCCCl)cs2)nc2ccccc12 |
| InChI | InChI=1S/C16H15ClN2S/c1-11-9-15(19-14-7-3-2-6-13(11)14)16-18-12(10-20-16)5-4-8-17/h2-3,6-7,9-10H,4-5,8H2,1H3 |
| InChIKey | PBUSYLNYSBFDNP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|