C9H9ClN2OS — CID 130517502
4-[4-(2-chloroethyl)-1,3-thiazol-2-yl]-2-methyl-1,3-oxazole (PubChem CID 130517502) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is 4-[4-(2-chloroethyl)-1,3-thiazol-2-yl]-2-methyl-1,3-oxazole.
| Compound Name | 4-[4-(2-chloroethyl)-1,3-thiazol-2-yl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 130517502 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 4-[4-(2-chloroethyl)-1,3-thiazol-2-yl]-2-methyl-1,3-oxazole |
| SMILES | Cc1nc(-c2nc(CCCl)cs2)co1 |
| InChI | InChI=1S/C9H9ClN2OS/c1-6-11-8(4-13-6)9-12-7(2-3-10)5-14-9/h4-5H,2-3H2,1H3 |
| InChIKey | UGTJBVAAWCMPAA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|