C8H9ClN4S — CID 130598605
4-(2-chloroethyl)-2-(1-methyltriazol-4-yl)-1,3-thiazole (PubChem CID 130598605) has the molecular formula C8H9ClN4S and a molecular weight of 228.71 g/mol. Its IUPAC name is 4-(2-chloroethyl)-2-(1-methyltriazol-4-yl)-1,3-thiazole.
| Compound Name | 4-(2-chloroethyl)-2-(1-methyltriazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 130598605 |
| Molecular Formula | C8H9ClN4S |
| Molecular Weight | 228.71 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 4-(2-chloroethyl)-2-(1-methyltriazol-4-yl)-1,3-thiazole |
| SMILES | Cn1cc(-c2nc(CCCl)cs2)nn1 |
| InChI | InChI=1S/C8H9ClN4S/c1-13-4-7(11-12-13)8-10-6(2-3-9)5-14-8/h4-5H,2-3H2,1H3 |
| InChIKey | VTONLDDLAUGCQL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.71 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|