C11H8Br2FNO — CID 114764166
3,4-dibromo-6-ethoxy-7-fluoroquinoline (PubChem CID 114764166) has the molecular formula C11H8Br2FNO and a molecular weight of 349.00 g/mol. Its IUPAC name is 3,4-dibromo-6-ethoxy-7-fluoroquinoline.
| Compound Name | 3,4-dibromo-6-ethoxy-7-fluoroquinoline |
|---|---|
| PubChem CID | 114764166 |
| Molecular Formula | C11H8Br2FNO |
| Molecular Weight | 349.00 g/mol |
| Exact Mass | 346.90 |
| IUPAC Name | 3,4-dibromo-6-ethoxy-7-fluoroquinoline |
| SMILES | CCOc1cc2c(Br)c(Br)cnc2cc1F |
| InChI | InChI=1S/C11H8Br2FNO/c1-2-16-10-3-6-9(4-8(10)14)15-5-7(12)11(6)13/h3-5H,2H2,1H3 |
| InChIKey | CHLMHRMZEMYUDA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |