About 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide
4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide (PubChem CID 114770673) has the molecular formula C10H11NO4S
and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide |
| PubChem CID | 114770673 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N=C=O)c(C)c1 |
| InChI | InChI=1S/C10H11NO4S/c1-7-4-9(15-3)5-8(2)10(7)16(13,14)11-6-12/h4-5H,1-3H3 |
| InChIKey | YCIACFGSJSWROD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide?
The IUPAC name of 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide (CID 114770673) is 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide.
What is the SMILES notation for 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide?
The canonical SMILES for 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide is COc1cc(C)c(S(=O)(=O)N=C=O)c(C)c1.
What is the InChIKey of 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide?
The InChIKey is YCIACFGSJSWROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c1-7-4-9(15-3)5-8(2)10(7)16(13,14)11-6-12/h4-5H,1-3H3.
What are the key properties of 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide?
4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide has a molecular weight of 241.27 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,6-dimethyl-N-(oxomethylidene)benzenesulfonamide is sourced from PubChem (CID 114770673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).