C13H13ClN2O4S — CID 114790046
5-[(4-chlorophenyl)methylsulfonylmethyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 114790046) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfonylmethyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-chlorophenyl)methylsulfonylmethyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114790046 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfonylmethyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1CS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O4S/c1-16-12(11(6-15-16)13(17)18)8-21(19,20)7-9-2-4-10(14)5-3-9/h2-6H,7-8H2,1H3,(H,17,18) |
| InChIKey | XFMWZRLPUFBYDB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |