C9H14N2O5S — CID 116630467
5-(2-methoxyethylsulfonylmethyl)-1-methylpyrazole-4-carboxylic acid (PubChem CID 116630467) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfonylmethyl)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(2-methoxyethylsulfonylmethyl)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116630467 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-(2-methoxyethylsulfonylmethyl)-1-methylpyrazole-4-carboxylic acid |
| SMILES | COCCS(=O)(=O)Cc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C9H14N2O5S/c1-11-8(7(5-10-11)9(12)13)6-17(14,15)4-3-16-2/h5H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | UIRWAHKIWDGSAJ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |