C10H16F3N3O2S — CID 114807735
2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)acetonitrile (PubChem CID 114807735) has the molecular formula C10H16F3N3O2S and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)acetonitrile.
| Compound Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)acetonitrile |
|---|---|
| PubChem CID | 114807735 |
| Molecular Formula | C10H16F3N3O2S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-cyclohexyl-2-(2,2,2-trifluoroethylsulfamoylamino)acetonitrile |
| SMILES | N#CC(NS(=O)(=O)NCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H16F3N3O2S/c11-10(12,13)7-15-19(17,18)16-9(6-14)8-4-2-1-3-5-8/h8-9,15-16H,1-5,7H2 |
| InChIKey | HKDDDJXVUWDACO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |