C8H12N4O2S2 — CID 114812032
5-(3-aminoprop-1-ynyl)-N-(ethylsulfamoyl)-1,3-thiazol-2-amine (PubChem CID 114812032) has the molecular formula C8H12N4O2S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(ethylsulfamoyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(ethylsulfamoyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114812032 |
| Molecular Formula | C8H12N4O2S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(ethylsulfamoyl)-1,3-thiazol-2-amine |
| SMILES | CCNS(=O)(=O)Nc1ncc(C#CCN)s1 |
| InChI | InChI=1S/C8H12N4O2S2/c1-2-11-16(13,14)12-8-10-6-7(15-8)4-3-5-9/h6,11H,2,5,9H2,1H3,(H,10,12) |
| InChIKey | QULNUUFFKGKWCY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|