C11H17N3O2S2 — CID 63856077
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-methylbutane-1-sulfonamide (PubChem CID 63856077) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-methylbutane-1-sulfonamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 63856077 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)Nc1ncc(C#CCN)s1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-9(2)5-7-18(15,16)14-11-13-8-10(17-11)4-3-6-12/h8-9H,5-7,12H2,1-2H3,(H,13,14) |
| InChIKey | ADNNULJTTSHRJO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|