C12H9N5O2S2 — CID 106598860
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2-cyanopyridine-3-sulfonamide (PubChem CID 106598860) has the molecular formula C12H9N5O2S2 and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2-cyanopyridine-3-sulfonamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106598860 |
| Molecular Formula | C12H9N5O2S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2-cyanopyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)Nc1ncc(C#CCN)s1 |
| InChI | InChI=1S/C12H9N5O2S2/c13-5-1-3-9-8-16-12(20-9)17-21(18,19)11-4-2-6-15-10(11)7-14/h2,4,6,8H,5,13H2,(H,16,17) |
| InChIKey | SZJDIQPJEHSIGE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|