C13H10N4O2S2 — CID 60812944
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-cyanobenzenesulfonamide (PubChem CID 60812944) has the molecular formula C13H10N4O2S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-cyanobenzenesulfonamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 60812944 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-3-cyanobenzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2ncc(C#CCN)s2)c1 |
| InChI | InChI=1S/C13H10N4O2S2/c14-6-2-4-11-9-16-13(20-11)17-21(18,19)12-5-1-3-10(7-12)8-15/h1,3,5,7,9H,6,14H2,(H,16,17) |
| InChIKey | WLSMHXBEDMSHKM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|