C10H16N4O2S2 — CID 60815113
5-(3-aminoprop-1-ynyl)-2-(diethylsulfamoylamino)-1,3-thiazole (PubChem CID 60815113) has the molecular formula C10H16N4O2S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-2-(diethylsulfamoylamino)-1,3-thiazole.
| Compound Name | 5-(3-aminoprop-1-ynyl)-2-(diethylsulfamoylamino)-1,3-thiazole |
|---|---|
| PubChem CID | 60815113 |
| Molecular Formula | C10H16N4O2S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-2-(diethylsulfamoylamino)-1,3-thiazole |
| SMILES | CCN(CC)S(=O)(=O)Nc1ncc(C#CCN)s1 |
| InChI | InChI=1S/C10H16N4O2S2/c1-3-14(4-2)18(15,16)13-10-12-8-9(17-10)6-5-7-11/h8H,3-4,7,11H2,1-2H3,(H,12,13) |
| InChIKey | VWRNZOHMTCEPAL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|