C10H22N4O4S — CID 114816139
N-ethyl-1-(2-methoxyethylsulfamoyl)piperazine-2-carboxamide (PubChem CID 114816139) has the molecular formula C10H22N4O4S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-ethyl-1-(2-methoxyethylsulfamoyl)piperazine-2-carboxamide.
| Compound Name | N-ethyl-1-(2-methoxyethylsulfamoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 114816139 |
| Molecular Formula | C10H22N4O4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-ethyl-1-(2-methoxyethylsulfamoyl)piperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1S(=O)(=O)NCCOC |
| InChI | InChI=1S/C10H22N4O4S/c1-3-12-10(15)9-8-11-4-6-14(9)19(16,17)13-5-7-18-2/h9,11,13H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | LWRPRWVVVCAMSO-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|