About 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine
3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine (PubChem CID 114827419) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine.
Analyze 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine?
The IUPAC name of 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine (CID 114827419) is 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine.
What is the SMILES notation for 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine?
The canonical SMILES for 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine is Cc1ccnc2c1NCC(C)S2.
What is the InChIKey of 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine?
The InChIKey is FYSKIWAFUAZMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-6-3-4-10-9-8(6)11-5-7(2)12-9/h3-4,7,11H,5H2,1-2H3.
What are the key properties of 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine?
3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine has a molecular weight of 180.28 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine is sourced from PubChem (CID 114827419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).