C18H35NOSi — CID 11483696
[(4S,9aR)-4-ethyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11483696) has the molecular formula C18H35NOSi and a molecular weight of 309.57 g/mol. Its IUPAC name is [(4S,9aR)-4-ethyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,9aR)-4-ethyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11483696 |
| Molecular Formula | C18H35NOSi |
| Molecular Weight | 309.57 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | [(4S,9aR)-4-ethyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1CC(CO[Si](C)(C)C(C)(C)C)=C[C@H]2CCCCN12 |
| InChI | InChI=1S/C18H35NOSi/c1-7-16-12-15(13-17-10-8-9-11-19(16)17)14-20-21(5,6)18(2,3)4/h13,16-17H,7-12,14H2,1-6H3/t16-,17+/m0/s1 |
| InChIKey | DGPOYDANFVQTEA-DLBZAZTESA-N |
| XLogP | 4.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|