C19H24N4O2 — CID 11484586
4-(butan-2-ylamino)-8-(diethylamino)chromeno[2,3-d]pyrimidin-2-one (PubChem CID 11484586) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(butan-2-ylamino)-8-(diethylamino)chromeno[2,3-d]pyrimidin-2-one.
| Compound Name | 4-(butan-2-ylamino)-8-(diethylamino)chromeno[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 11484586 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-(butan-2-ylamino)-8-(diethylamino)chromeno[2,3-d]pyrimidin-2-one |
| SMILES | CCC(C)Nc1nc(=O)nc2oc3cc(N(CC)CC)ccc3cc1-2 |
| InChI | InChI=1S/C19H24N4O2/c1-5-12(4)20-17-15-10-13-8-9-14(23(6-2)7-3)11-16(13)25-18(15)22-19(24)21-17/h8-12H,5-7H2,1-4H3,(H,20,21,24) |
| InChIKey | NMDDDDUWCUHLBA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|