C21H28N2O3 — CID 11485082
1-(2-acetyl-7-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-8-yl)hexan-1-one (PubChem CID 11485082) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(2-acetyl-7-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-8-yl)hexan-1-one.
| Compound Name | 1-(2-acetyl-7-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-8-yl)hexan-1-one |
|---|---|
| PubChem CID | 11485082 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-(2-acetyl-7-methoxy-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-8-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1c(OC)ccc2c3c([nH]c12)C(C)N(C(C)=O)CC3 |
| InChI | InChI=1S/C21H28N2O3/c1-5-6-7-8-17(25)19-18(26-4)10-9-15-16-11-12-23(14(3)24)13(2)20(16)22-21(15)19/h9-10,13,22H,5-8,11-12H2,1-4H3 |
| InChIKey | XOKMNUXHXRPWOT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|