C18H27ClN2 — CID 114851666
4-chloro-N,N-bis(cyclopropylmethyl)-2-(propylaminomethyl)aniline (PubChem CID 114851666) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 4-chloro-N,N-bis(cyclopropylmethyl)-2-(propylaminomethyl)aniline.
| Compound Name | 4-chloro-N,N-bis(cyclopropylmethyl)-2-(propylaminomethyl)aniline |
|---|---|
| PubChem CID | 114851666 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 4-chloro-N,N-bis(cyclopropylmethyl)-2-(propylaminomethyl)aniline |
| SMILES | CCCNCc1cc(Cl)ccc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C18H27ClN2/c1-2-9-20-11-16-10-17(19)7-8-18(16)21(12-14-3-4-14)13-15-5-6-15/h7-8,10,14-15,20H,2-6,9,11-13H2,1H3 |
| InChIKey | LKVUOTUSCBVIOS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|