C14H13BrN2OS — CID 114907972
3-amino-6-bromo-N-(2-methylbut-3-yn-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 114907972) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is 3-amino-6-bromo-N-(2-methylbut-3-yn-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-(2-methylbut-3-yn-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907972 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 3-amino-6-bromo-N-(2-methylbut-3-yn-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C14H13BrN2OS/c1-4-14(2,3)17-13(18)12-11(16)9-6-5-8(15)7-10(9)19-12/h1,5-7H,16H2,2-3H3,(H,17,18) |
| InChIKey | ZLCPBRMGEZJOJH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|