C45H50O5S — CID 11490980
(2S,3S,4S,5R,6R)-2-[(1S)-1-methoxy-2-methyl-1-phenylpropan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 11490980) has the molecular formula C45H50O5S and a molecular weight of 702.96 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[(1S)-1-methoxy-2-methyl-1-phenylpropan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-[(1S)-1-methoxy-2-methyl-1-phenylpropan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 11490980 |
| Molecular Formula | C45H50O5S |
| Molecular Weight | 702.96 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[(1S)-1-methoxy-2-methyl-1-phenylpropan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CO[C@@H](c1ccccc1)C(C)(C)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C45H50O5S/c1-33-25-27-38(28-26-33)51-42-41(49-31-36-21-13-7-14-22-36)40(48-30-35-19-11-6-12-20-35)39(32-47-29-34-17-9-5-10-18-34)50-44(42)45(2,3)43(46-4)37-23-15-8-16-24-37/h5-28,39-44H,29-32H2,1-4H3/t39-,40-,41+,42-,43+,44-/m1/s1 |
| InChIKey | GZABZNFUOIHIDT-LRKIELSCSA-N |
| XLogP | 10.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.96 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |