C16H34OSi — CID 11492749
tert-butyl-dimethyl-[(4R)-8-methylnon-1-en-4-yl]oxysilane (PubChem CID 11492749) has the molecular formula C16H34OSi and a molecular weight of 270.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R)-8-methylnon-1-en-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4R)-8-methylnon-1-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 11492749 |
| Molecular Formula | C16H34OSi |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | tert-butyl-dimethyl-[(4R)-8-methylnon-1-en-4-yl]oxysilane |
| SMILES | C=CC[C@@H](CCCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34OSi/c1-9-11-15(13-10-12-14(2)3)17-18(7,8)16(4,5)6/h9,14-15H,1,10-13H2,2-8H3/t15-/m0/s1 |
| InChIKey | PRFDCRTVIXEDPB-HNNXBMFYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|