C11H9F2N3O4S — CID 114935276
1-[(2,6-difluorophenyl)methyl]-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 114935276) has the molecular formula C11H9F2N3O4S and a molecular weight of 317.27 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 114935276 |
| Molecular Formula | C11H9F2N3O4S |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(Cc2c(F)cccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9F2N3O4S/c12-7-2-1-3-8(13)6(7)4-16-5-9(21(14,19)20)10(17)15-11(16)18/h1-3,5H,4H2,(H2,14,19,20)(H,15,17,18) |
| InChIKey | XKTRABKHUAJZRR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |