C16H16N2S2 — CID 114955043
N-[(4-methyl-3-pyridinyl)methyl]-1-(4-thiophen-2-ylthiophen-2-yl)methanamine (PubChem CID 114955043) has the molecular formula C16H16N2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[(4-methyl-3-pyridinyl)methyl]-1-(4-thiophen-2-ylthiophen-2-yl)methanamine.
| Compound Name | N-[(4-methyl-3-pyridinyl)methyl]-1-(4-thiophen-2-ylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 114955043 |
| Molecular Formula | C16H16N2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[(4-methyl-3-pyridinyl)methyl]-1-(4-thiophen-2-ylthiophen-2-yl)methanamine |
| SMILES | Cc1ccncc1CNCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H16N2S2/c1-12-4-5-17-8-14(12)9-18-10-15-7-13(11-20-15)16-3-2-6-19-16/h2-8,11,18H,9-10H2,1H3 |
| InChIKey | RYAXEQQEEORENS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |