About N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine
N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine (PubChem CID 114183142) has the molecular formula C12H11N3OS2
and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine |
| PubChem CID | 114183142 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine |
| SMILES | c1csc(-c2csc(CNCc3ncon3)c2)c1 |
| InChI | InChI=1S/C12H11N3OS2/c1-2-11(17-3-1)9-4-10(18-7-9)5-13-6-12-14-8-16-15-12/h1-4,7-8,13H,5-6H2 |
| InChIKey | WCQJZEKNCCJPPA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine?
The IUPAC name of N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine (CID 114183142) is N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine.
What is the SMILES notation for N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine?
The canonical SMILES for N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine is c1csc(-c2csc(CNCc3ncon3)c2)c1.
What is the InChIKey of N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine?
The InChIKey is WCQJZEKNCCJPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3OS2/c1-2-11(17-3-1)9-4-10(18-7-9)5-13-6-12-14-8-16-15-12/h1-4,7-8,13H,5-6H2.
What are the key properties of N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine?
N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine has a molecular weight of 277.37 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2,4-oxadiazol-3-ylmethyl)-1-(4-thiophen-2-ylthiophen-2-yl)methanamine is sourced from PubChem (CID 114183142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).