C26H29N3O3 — CID 11495718
4-(4-ethoxyphenyl)-N-(furan-2-ylmethyl)-N-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 11495718) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-(furan-2-ylmethyl)-N-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | 4-(4-ethoxyphenyl)-N-(furan-2-ylmethyl)-N-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 11495718 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-(furan-2-ylmethyl)-N-methyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | CCOc1ccc(C2Nc3ccc(C(=O)N(C)Cc4ccco4)cc3C3NCCC23)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-3-31-19-9-6-17(7-10-19)24-21-12-13-27-25(21)22-15-18(8-11-23(22)28-24)26(30)29(2)16-20-5-4-14-32-20/h4-11,14-15,21,24-25,27-28H,3,12-13,16H2,1-2H3 |
| InChIKey | AWTBJJWKMLKFHS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |