C29H37N3O4 — CID 58919437
prop-2-enyl (4aS,10bS)-9-(diethylcarbamoyl)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate (PubChem CID 58919437) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is prop-2-enyl (4aS,10bS)-9-(diethylcarbamoyl)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate.
| Compound Name | prop-2-enyl (4aS,10bS)-9-(diethylcarbamoyl)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 58919437 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | prop-2-enyl (4aS,10bS)-9-(diethylcarbamoyl)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@H]2C(c3ccc(OCC)cc3)Nc3ccc(C(=O)N(CC)CC)cc3[C@H]21 |
| InChI | InChI=1S/C29H37N3O4/c1-5-18-36-29(34)32-17-9-10-23-26(20-11-14-22(15-12-20)35-8-4)30-25-16-13-21(19-24(25)27(23)32)28(33)31(6-2)7-3/h5,11-16,19,23,26-27,30H,1,6-10,17-18H2,2-4H3/t23-,26?,27-/m0/s1 |
| InChIKey | BYVABHJXZMXIEP-BBDOPMDFSA-N |
| XLogP | 5.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|