C24H27N3O4 — CID 58919341
prop-2-enyl (3aS,9bS)-8-(cyclobutylcarbamoyl)-4-(furan-2-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 58919341) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is prop-2-enyl (3aS,9bS)-8-(cyclobutylcarbamoyl)-4-(furan-2-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | prop-2-enyl (3aS,9bS)-8-(cyclobutylcarbamoyl)-4-(furan-2-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 58919341 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | prop-2-enyl (3aS,9bS)-8-(cyclobutylcarbamoyl)-4-(furan-2-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC[C@H]2C(c3ccco3)Nc3ccc(C(=O)NC4CCC4)cc3[C@H]21 |
| InChI | InChI=1S/C24H27N3O4/c1-2-12-31-24(29)27-11-10-17-21(20-7-4-13-30-20)26-19-9-8-15(14-18(19)22(17)27)23(28)25-16-5-3-6-16/h2,4,7-9,13-14,16-17,21-22,26H,1,3,5-6,10-12H2,(H,25,28)/t17-,21?,22-/m0/s1 |
| InChIKey | HZQBIDJIKHJIEK-OWHMDLSXSA-N |
| XLogP | 4.41 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|