C20H23N3O — CID 11659781
N,N-dimethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 11659781) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N,N-dimethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | N,N-dimethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 11659781 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N,N-dimethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)C1NCCC1C(c1ccccc1)N2 |
| InChI | InChI=1S/C20H23N3O/c1-23(2)20(24)14-8-9-17-16(12-14)19-15(10-11-21-19)18(22-17)13-6-4-3-5-7-13/h3-9,12,15,18-19,21-22H,10-11H2,1-2H3 |
| InChIKey | GRHCAVRHIJKUAK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |