C26H36N4O — CID 58919298
(3aR,9bS)-N-[2-[di(propan-2-yl)amino]ethyl]-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 58919298) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is (3aR,9bS)-N-[2-[di(propan-2-yl)amino]ethyl]-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | (3aR,9bS)-N-[2-[di(propan-2-yl)amino]ethyl]-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 58919298 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (3aR,9bS)-N-[2-[di(propan-2-yl)amino]ethyl]-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | CC(C)N(CCNC(=O)c1ccc2c(c1)[C@H]1NCC[C@H]1C(c1ccccc1)N2)C(C)C |
| InChI | InChI=1S/C26H36N4O/c1-17(2)30(18(3)4)15-14-28-26(31)20-10-11-23-22(16-20)25-21(12-13-27-25)24(29-23)19-8-6-5-7-9-19/h5-11,16-18,21,24-25,27,29H,12-15H2,1-4H3,(H,28,31)/t21-,24?,25-/m0/s1 |
| InChIKey | JHVWLXCTNQHXNB-BIYQJSDESA-N |
| XLogP | 4.35 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |