C25H23NO6 — CID 11495744
11-[(3,4,5-trimethoxyphenyl)methoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]acridine (PubChem CID 11495744) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 11-[(3,4,5-trimethoxyphenyl)methoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]acridine.
| Compound Name | 11-[(3,4,5-trimethoxyphenyl)methoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]acridine |
|---|---|
| PubChem CID | 11495744 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 11-[(3,4,5-trimethoxyphenyl)methoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]acridine |
| SMILES | COc1cc(COc2c3ccccc3nc3cc4c(cc23)OCCO4)cc(OC)c1OC |
| InChI | InChI=1S/C25H23NO6/c1-27-22-10-15(11-23(28-2)25(22)29-3)14-32-24-16-6-4-5-7-18(16)26-19-13-21-20(12-17(19)24)30-8-9-31-21/h4-7,10-13H,8-9,14H2,1-3H3 |
| InChIKey | FDOCRXRSZGTUQH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|