C10H7ClF2N2 — CID 114990648
4-[chloro-(3,4-difluorophenyl)methyl]-1H-pyrazole (PubChem CID 114990648) has the molecular formula C10H7ClF2N2 and a molecular weight of 228.63 g/mol. Its IUPAC name is 4-[chloro-(3,4-difluorophenyl)methyl]-1H-pyrazole.
| Compound Name | 4-[chloro-(3,4-difluorophenyl)methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 114990648 |
| Molecular Formula | C10H7ClF2N2 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 4-[chloro-(3,4-difluorophenyl)methyl]-1H-pyrazole |
| SMILES | Fc1ccc(C(Cl)c2cn[nH]c2)cc1F |
| InChI | InChI=1S/C10H7ClF2N2/c11-10(7-4-14-15-5-7)6-1-2-8(12)9(13)3-6/h1-5,10H,(H,14,15) |
| InChIKey | INBBAAZXOPKMHZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|