C13H18N2O — CID 115007297
10-methyl-2,3,4,4a,5,10a-hexahydro-1H-benzo[b][1,7]naphthyridin-8-ol (PubChem CID 115007297) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 10-methyl-2,3,4,4a,5,10a-hexahydro-1H-benzo[b][1,7]naphthyridin-8-ol.
| Compound Name | 10-methyl-2,3,4,4a,5,10a-hexahydro-1H-benzo[b][1,7]naphthyridin-8-ol |
|---|---|
| PubChem CID | 115007297 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 10-methyl-2,3,4,4a,5,10a-hexahydro-1H-benzo[b][1,7]naphthyridin-8-ol |
| SMILES | CN1c2cc(O)ccc2CC2CCNCC21 |
| InChI | InChI=1S/C13H18N2O/c1-15-12-7-11(16)3-2-9(12)6-10-4-5-14-8-13(10)15/h2-3,7,10,13-14,16H,4-6,8H2,1H3 |
| InChIKey | GUMJCMYJGYIHRN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |