C9H15N3S — CID 115021194
[5-methyl-4-(thiolan-2-yl)-1H-imidazol-2-yl]methanamine (PubChem CID 115021194) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is [5-methyl-4-(thiolan-2-yl)-1H-imidazol-2-yl]methanamine.
| Compound Name | [5-methyl-4-(thiolan-2-yl)-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 115021194 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | [5-methyl-4-(thiolan-2-yl)-1H-imidazol-2-yl]methanamine |
| SMILES | Cc1[nH]c(CN)nc1C1CCCS1 |
| InChI | InChI=1S/C9H15N3S/c1-6-9(7-3-2-4-13-7)12-8(5-10)11-6/h7H,2-5,10H2,1H3,(H,11,12) |
| InChIKey | IPSIUIHIEMYYEL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |