C12H14FNO2 — CID 115033850
methyl 2-(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)acetate (PubChem CID 115033850) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is methyl 2-(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)acetate.
| Compound Name | methyl 2-(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)acetate |
|---|---|
| PubChem CID | 115033850 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 2-(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)acetate |
| SMILES | COC(=O)CC1CN(C)c2cccc(F)c21 |
| InChI | InChI=1S/C12H14FNO2/c1-14-7-8(6-11(15)16-2)12-9(13)4-3-5-10(12)14/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | LFLJUXRYTKXCLG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |