About 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine
2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 115042613) has the molecular formula C14H14N4
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 115042613 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | Cc1ccc(-c2cnc3c(N)c(C)nn3c2)cc1 |
| InChI | InChI=1S/C14H14N4/c1-9-3-5-11(6-4-9)12-7-16-14-13(15)10(2)17-18(14)8-12/h3-8H,15H2,1-2H3 |
| InChIKey | UAMNXTLRGZXUGI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine (CID 115042613) is 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine is Cc1ccc(-c2cnc3c(N)c(C)nn3c2)cc1.
What is the InChIKey of 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is UAMNXTLRGZXUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4/c1-9-3-5-11(6-4-9)12-7-16-14-13(15)10(2)17-18(14)8-12/h3-8H,15H2,1-2H3.
What are the key properties of 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine?
2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 238.29 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 115042613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).