C12H13FO3S — CID 115047789
4-[(1,1-dioxothiolan-3-yl)-fluoromethyl]benzaldehyde (PubChem CID 115047789) has the molecular formula C12H13FO3S and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-fluoromethyl]benzaldehyde.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-fluoromethyl]benzaldehyde |
|---|---|
| PubChem CID | 115047789 |
| Molecular Formula | C12H13FO3S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-fluoromethyl]benzaldehyde |
| SMILES | O=Cc1ccc(C(F)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H13FO3S/c13-12(11-5-6-17(15,16)8-11)10-3-1-9(7-14)2-4-10/h1-4,7,11-12H,5-6,8H2 |
| InChIKey | OJCJPGGURMWPSK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|