C11H10BrF2N3 — CID 115053464
2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroethanamine (PubChem CID 115053464) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroethanamine.
| Compound Name | 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115053464 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroethanamine |
| SMILES | NCC(F)(F)c1c(Br)cnn1-c1ccccc1 |
| InChI | InChI=1S/C11H10BrF2N3/c12-9-6-16-17(8-4-2-1-3-5-8)10(9)11(13,14)7-15/h1-6H,7,15H2 |
| InChIKey | VKRLZHRTSMSVGH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |