2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid

C11H7BrF2N2O2 — CID 115053519

IUPAC2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1c(Br)cnn1-c1ccccc1
InChIInChI=1S/C11H7BrF2N2O2/c12-8-6-15-16(7-4-2-1-3-5-7)9(8)11(13,14)10(17)18/h1-6H,(H,17,18)
InChIKeyKGLJEITVULQGCQ-UHFFFAOYSA-N
MW317.09 g/mol
LogP2.81
Rot. Bonds3

About 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid

2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid (PubChem CID 115053519) has the molecular formula C11H7BrF2N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid
PubChem CID115053519
Molecular FormulaC11H7BrF2N2O2
Molecular Weight317.09 g/mol
Exact Mass315.97
IUPAC Name2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1c(Br)cnn1-c1ccccc1
InChIInChI=1S/C11H7BrF2N2O2/c12-8-6-15-16(7-4-2-1-3-5-7)9(8)11(13,14)10(17)18/h1-6H,(H,17,18)
InChIKeyKGLJEITVULQGCQ-UHFFFAOYSA-N
XLogP2.81
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.09
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid?
The IUPAC name of 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid (CID 115053519) is 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid is O=C(O)C(F)(F)c1c(Br)cnn1-c1ccccc1.
What is the InChIKey of 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid?
The InChIKey is KGLJEITVULQGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrF2N2O2/c12-8-6-15-16(7-4-2-1-3-5-7)9(8)11(13,14)10(17)18/h1-6H,(H,17,18).
What are the key properties of 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid?
2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid has a molecular weight of 317.09 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-1-phenylpyrazol-5-yl)-2,2-difluoroacetic acid is sourced from PubChem (CID 115053519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).