C19H26O5 — CID 11508266
(1R,3R,6R,7R,10S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-10-ethenyl-3-methoxy-6-methyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 11508266) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1R,3R,6R,7R,10S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-10-ethenyl-3-methoxy-6-methyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1R,3R,6R,7R,10S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-10-ethenyl-3-methoxy-6-methyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 11508266 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1R,3R,6R,7R,10S)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-10-ethenyl-3-methoxy-6-methyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | C=C[C@H]1[C@H]2C=C(C3OCC(C)(C)CO3)[C@@H]3[C@@](OC)(OC[C@@]31C)C2=O |
| InChI | InChI=1S/C19H26O5/c1-6-13-11-7-12(16-22-8-17(2,3)9-23-16)14-18(13,4)10-24-19(14,21-5)15(11)20/h6-7,11,13-14,16H,1,8-10H2,2-5H3/t11-,13+,14+,18-,19-/m1/s1 |
| InChIKey | LJWBWGRRABFHKY-MLOYEQCSSA-N |
| XLogP | 2.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|