C9H8BrNO2S — CID 115083524
1-[2-(5-bromothiophen-2-yl)-1,3-oxazol-4-yl]ethanol (PubChem CID 115083524) has the molecular formula C9H8BrNO2S and a molecular weight of 274.14 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 115083524 |
| Molecular Formula | C9H8BrNO2S |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)-1,3-oxazol-4-yl]ethanol |
| SMILES | CC(O)c1coc(-c2ccc(Br)s2)n1 |
| InChI | InChI=1S/C9H8BrNO2S/c1-5(12)6-4-13-9(11-6)7-2-3-8(10)14-7/h2-5,12H,1H3 |
| InChIKey | BTHWRCWISKGCJU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |